About (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride
(3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride (PubChem CID 131182973) has the molecular formula C9H19ClN2O2S
and a molecular weight of 254.78 g/mol. Its IUPAC name is (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride |
| PubChem CID | 131182973 |
| Molecular Formula | C9H19ClN2O2S |
| Molecular Weight | 254.78 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride |
| SMILES | CC1CN([C@@H]2CNC[C@H]2O)CCS1=O.Cl |
| InChI | InChI=1S/C9H18N2O2S.ClH/c1-7-6-11(2-3-14(7)13)8-4-10-5-9(8)12;/h7-10,12H,2-6H2,1H3;1H/t7?,8-,9-,14?;/m1./s1 |
| InChIKey | JVDGPPBFKDYYGH-UGTBIWRSSA-N |
| XLogP | -0.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.78 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride?
The IUPAC name of (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride (CID 131182973) is (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride.
What is the SMILES notation for (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride?
The canonical SMILES for (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride is CC1CN([C@@H]2CNC[C@H]2O)CCS1=O.Cl.
What is the InChIKey of (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride?
The InChIKey is JVDGPPBFKDYYGH-UGTBIWRSSA-N. The full InChI is InChI=1S/C9H18N2O2S.ClH/c1-7-6-11(2-3-14(7)13)8-4-10-5-9(8)12;/h7-10,12H,2-6H2,1H3;1H/t7?,8-,9-,14?;/m1./s1.
What are the key properties of (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride?
(3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride has a molecular weight of 254.78 g/mol, XLogP of -0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-(2-methyl-1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol;hydrochloride is sourced from PubChem (CID 131182973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).