C8H16N2OS — CID 130725335
4-(azetidin-3-yl)-2-methyl-1,4-thiazinane 1-oxide (PubChem CID 130725335) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-2-methyl-1,4-thiazinane 1-oxide.
| Compound Name | 4-(azetidin-3-yl)-2-methyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 130725335 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 4-(azetidin-3-yl)-2-methyl-1,4-thiazinane 1-oxide |
| SMILES | CC1CN(C2CNC2)CCS1=O |
| InChI | InChI=1S/C8H16N2OS/c1-7-6-10(2-3-12(7)11)8-4-9-5-8/h7-9H,2-6H2,1H3 |
| InChIKey | HMQXBJGQESYSDU-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |