About 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide
4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide (PubChem CID 130791969) has the molecular formula C9H18N2O2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide.
Analyze 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide (CID 130791969) is 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide is CC1CN(C2CNC2)CC(C)S1(=O)=O.
What is the InChIKey of 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide?
The InChIKey is QGKAGLBIGOAOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S/c1-7-5-11(9-3-10-4-9)6-8(2)14(7,12)13/h7-10H,3-6H2,1-2H3.
What are the key properties of 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide?
4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide has a molecular weight of 218.32 g/mol, XLogP of -0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azetidin-3-yl)-2,6-dimethyl-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 130791969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).