C7H14N2O2 — CID 106674356
1-(azetidin-3-yl)pyrrolidine-3,4-diol (PubChem CID 106674356) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-(azetidin-3-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(azetidin-3-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674356 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1-(azetidin-3-yl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(C2CNC2)CC1O |
| InChI | InChI=1S/C7H14N2O2/c10-6-3-9(4-7(6)11)5-1-8-2-5/h5-8,10-11H,1-4H2 |
| InChIKey | CARRHJJCDQUWNF-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |