About [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten
[1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten (PubChem CID 154680933) has the molecular formula C11H22N3OW-
and a molecular weight of 396.16 g/mol. Its IUPAC name is [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten.
Molecular Properties
| Compound Name | [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten |
| PubChem CID | 154680933 |
| Molecular Formula | C11H22N3OW- |
| Molecular Weight | 396.16 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten |
| SMILES | CC.[NH-]C(=O)C1CCN(C2CNC2)CC1.[W] |
| InChI | InChI=1S/C9H17N3O.C2H6.W/c10-9(13)7-1-3-12(4-2-7)8-5-11-6-8;1-2;/h7-8,11H,1-6H2,(H2,10,13);1-2H3;/p-1 |
| InChIKey | SLFJPNKHXGMWOC-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten?
The IUPAC name of [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten (CID 154680933) is [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten.
What is the SMILES notation for [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten?
The canonical SMILES for [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten is CC.[NH-]C(=O)C1CCN(C2CNC2)CC1.[W].
What is the InChIKey of [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten?
The InChIKey is SLFJPNKHXGMWOC-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H17N3O.C2H6.W/c10-9(13)7-1-3-12(4-2-7)8-5-11-6-8;1-2;/h7-8,11H,1-6H2,(H2,10,13);1-2H3;/p-1.
What are the key properties of [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten?
[1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten has a molecular weight of 396.16 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(azetidin-3-yl)piperidine-4-carbonyl]azanide;ethane;tungsten is sourced from PubChem (CID 154680933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).