C9H16N2O2 — CID 146155819
1-(azetidin-3-yl)piperidine-4-carboxylic acid (PubChem CID 146155819) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-(azetidin-3-yl)piperidine-4-carboxylic acid.
| Compound Name | 1-(azetidin-3-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 146155819 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-(azetidin-3-yl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C2CNC2)CC1 |
| InChI | InChI=1S/C9H16N2O2/c12-9(13)7-1-3-11(4-2-7)8-5-10-6-8/h7-8,10H,1-6H2,(H,12,13) |
| InChIKey | WCRRIIGHCBVLDO-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |