C15H31N3O — CID 166167704
ethane;N-methyl-1-(1-methylpiperidin-4-yl)piperidine-4-carboxamide (PubChem CID 166167704) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is ethane;N-methyl-1-(1-methylpiperidin-4-yl)piperidine-4-carboxamide.
| Compound Name | ethane;N-methyl-1-(1-methylpiperidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166167704 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | ethane;N-methyl-1-(1-methylpiperidin-4-yl)piperidine-4-carboxamide |
| SMILES | CC.CNC(=O)C1CCN(C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C13H25N3O.C2H6/c1-14-13(17)11-3-9-16(10-4-11)12-5-7-15(2)8-6-12;1-2/h11-12H,3-10H2,1-2H3,(H,14,17);1-2H3 |
| InChIKey | AKHQREYKBAOMGC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |