C16H30N4O — CID 166945999
[3-(methylamino)cyclobutyl]-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]methanone (PubChem CID 166945999) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is [3-(methylamino)cyclobutyl]-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | [3-(methylamino)cyclobutyl]-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 166945999 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | [3-(methylamino)cyclobutyl]-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]methanone |
| SMILES | CNC1CC(C(=O)N2CCN(C3CCN(C)CC3)CC2)C1 |
| InChI | InChI=1S/C16H30N4O/c1-17-14-11-13(12-14)16(21)20-9-7-19(8-10-20)15-3-5-18(2)6-4-15/h13-15,17H,3-12H2,1-2H3 |
| InChIKey | DDRLVKIJZXBGBO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |