C13H28N4O — CID 143900234
ethane;4-(1-methylpiperidin-4-yl)piperazine-1-carboxamide (PubChem CID 143900234) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is ethane;4-(1-methylpiperidin-4-yl)piperazine-1-carboxamide.
| Compound Name | ethane;4-(1-methylpiperidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 143900234 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | ethane;4-(1-methylpiperidin-4-yl)piperazine-1-carboxamide |
| SMILES | CC.CN1CCC(N2CCN(C(N)=O)CC2)CC1 |
| InChI | InChI=1S/C11H22N4O.C2H6/c1-13-4-2-10(3-5-13)14-6-8-15(9-7-14)11(12)16;1-2/h10H,2-9H2,1H3,(H2,12,16);1-2H3 |
| InChIKey | VFHYHJHXSOCBHS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |