C19H36N4O — CID 91082020
(2R)-2-amino-2-cyclohexyl-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]propan-1-one (PubChem CID 91082020) has the molecular formula C19H36N4O and a molecular weight of 336.52 g/mol. Its IUPAC name is (2R)-2-amino-2-cyclohexyl-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]propan-1-one.
| Compound Name | (2R)-2-amino-2-cyclohexyl-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 91082020 |
| Molecular Formula | C19H36N4O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | (2R)-2-amino-2-cyclohexyl-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]propan-1-one |
| SMILES | CN1CCC(N2CCN(C(=O)[C@](C)(N)C3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C19H36N4O/c1-19(20,16-6-4-3-5-7-16)18(24)23-14-12-22(13-15-23)17-8-10-21(2)11-9-17/h16-17H,3-15,20H2,1-2H3/t19-/m1/s1 |
| InChIKey | KAXDCCRVMHPJSP-LJQANCHMSA-N |
| XLogP | 1.52 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |