C20H37N3O — CID 91173191
(2R)-2-amino-2-cyclohexyl-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]propan-1-one (PubChem CID 91173191) has the molecular formula C20H37N3O and a molecular weight of 335.54 g/mol. Its IUPAC name is (2R)-2-amino-2-cyclohexyl-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]propan-1-one.
| Compound Name | (2R)-2-amino-2-cyclohexyl-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 91173191 |
| Molecular Formula | C20H37N3O |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.29 |
| IUPAC Name | (2R)-2-amino-2-cyclohexyl-1-[4-(1-methylpiperidin-4-yl)piperidin-1-yl]propan-1-one |
| SMILES | CN1CCC(C2CCN(C(=O)[C@](C)(N)C3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C20H37N3O/c1-20(21,18-6-4-3-5-7-18)19(24)23-14-10-17(11-15-23)16-8-12-22(2)13-9-16/h16-18H,3-15,21H2,1-2H3/t20-/m1/s1 |
| InChIKey | YFCKPOQULKOOQJ-HXUWFJFHSA-N |
| XLogP | 2.86 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |