C16H30N2O — CID 110667071
1-[4-(azepan-1-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 110667071) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 1-[4-(azepan-1-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(azepan-1-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 110667071 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 1-[4-(azepan-1-yl)piperidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCC(N2CCCCCC2)CC1 |
| InChI | InChI=1S/C16H30N2O/c1-16(2,3)15(19)18-12-8-14(9-13-18)17-10-6-4-5-7-11-17/h14H,4-13H2,1-3H3 |
| InChIKey | SNIMQQXTMOXFGW-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |