C13H20F4N2O — CID 103733241
2,2,3,3-tetrafluoro-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one (PubChem CID 103733241) has the molecular formula C13H20F4N2O and a molecular weight of 296.31 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one.
| Compound Name | 2,2,3,3-tetrafluoro-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 103733241 |
| Molecular Formula | C13H20F4N2O |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1-(4-piperidin-1-ylpiperidin-1-yl)propan-1-one |
| SMILES | O=C(N1CCC(N2CCCCC2)CC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H20F4N2O/c14-11(15)13(16,17)12(20)19-8-4-10(5-9-19)18-6-2-1-3-7-18/h10-11H,1-9H2 |
| InChIKey | ICJKGTBYPTUFLY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|