C10H16F3NO2 — CID 71116090
1-cyclopropylpiperidine;2,2,2-trifluoroacetic acid (PubChem CID 71116090) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is 1-cyclopropylpiperidine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-cyclopropylpiperidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71116090 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-cyclopropylpiperidine;2,2,2-trifluoroacetic acid |
| SMILES | C1CCN(C2CC2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H15N.C2HF3O2/c1-2-6-9(7-3-1)8-4-5-8;3-2(4,5)1(6)7/h8H,1-7H2;(H,6,7) |
| InChIKey | UPYIRPQIMZIJIY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |