C12H19F3N2O — CID 24744899
2,2,2-trifluoro-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone (PubChem CID 24744899) has the molecular formula C12H19F3N2O and a molecular weight of 264.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 24744899 |
| Molecular Formula | C12H19F3N2O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-piperidin-1-ylpiperidin-1-yl)ethanone |
| SMILES | O=C(N1CCC(N2CCCCC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O/c13-12(14,15)11(18)17-8-4-10(5-9-17)16-6-2-1-3-7-16/h10H,1-9H2 |
| InChIKey | DQAGGGYIGDZVEV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |