C9H10F3NO — CID 126598063
1-(4-ethynylpiperidin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 126598063) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is 1-(4-ethynylpiperidin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(4-ethynylpiperidin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 126598063 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 1-(4-ethynylpiperidin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | C#CC1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H10F3NO/c1-2-7-3-5-13(6-4-7)8(14)9(10,11)12/h1,7H,3-6H2 |
| InChIKey | MKDRIPZJZLQYEK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|