C9H11F2NO — CID 126598081
1-(4-ethynylpiperidin-1-yl)-2,2-difluoroethanone (PubChem CID 126598081) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 1-(4-ethynylpiperidin-1-yl)-2,2-difluoroethanone.
| Compound Name | 1-(4-ethynylpiperidin-1-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 126598081 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 1-(4-ethynylpiperidin-1-yl)-2,2-difluoroethanone |
| SMILES | C#CC1CCN(C(=O)C(F)F)CC1 |
| InChI | InChI=1S/C9H11F2NO/c1-2-7-3-5-12(6-4-7)9(13)8(10)11/h1,7-8H,3-6H2 |
| InChIKey | VXRNONKHGZVVOV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|