C6H10F2N2O — CID 103514259
1-[(3S)-3-aminopyrrolidin-1-yl]-2,2-difluoroethanone (PubChem CID 103514259) has the molecular formula C6H10F2N2O and a molecular weight of 164.16 g/mol. Its IUPAC name is 1-[(3S)-3-aminopyrrolidin-1-yl]-2,2-difluoroethanone.
| Compound Name | 1-[(3S)-3-aminopyrrolidin-1-yl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 103514259 |
| Molecular Formula | C6H10F2N2O |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1-[(3S)-3-aminopyrrolidin-1-yl]-2,2-difluoroethanone |
| SMILES | N[C@H]1CCN(C(=O)C(F)F)C1 |
| InChI | InChI=1S/C6H10F2N2O/c7-5(8)6(11)10-2-1-4(9)3-10/h4-5H,1-3,9H2/t4-/m0/s1 |
| InChIKey | DOIBWIQUICWWQZ-BYPYZUCNSA-N |
| XLogP | -0.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |