C6H9F2NO — CID 131153900
2,2-difluoro-1-(3-methylazetidin-1-yl)ethanone (PubChem CID 131153900) has the molecular formula C6H9F2NO and a molecular weight of 149.14 g/mol. Its IUPAC name is 2,2-difluoro-1-(3-methylazetidin-1-yl)ethanone.
| Compound Name | 2,2-difluoro-1-(3-methylazetidin-1-yl)ethanone |
|---|---|
| PubChem CID | 131153900 |
| Molecular Formula | C6H9F2NO |
| Molecular Weight | 149.14 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 2,2-difluoro-1-(3-methylazetidin-1-yl)ethanone |
| SMILES | CC1CN(C(=O)C(F)F)C1 |
| InChI | InChI=1S/C6H9F2NO/c1-4-2-9(3-4)6(10)5(7)8/h4-5H,2-3H2,1H3 |
| InChIKey | SXVPIKPHHFKCDC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |