C10H14F4N2O — CID 113250977
1-(4-cyclopropylpiperazin-1-yl)-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 113250977) has the molecular formula C10H14F4N2O and a molecular weight of 254.23 g/mol. Its IUPAC name is 1-(4-cyclopropylpiperazin-1-yl)-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-(4-cyclopropylpiperazin-1-yl)-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 113250977 |
| Molecular Formula | C10H14F4N2O |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 1-(4-cyclopropylpiperazin-1-yl)-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | O=C(N1CCN(C2CC2)CC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H14F4N2O/c11-8(12)10(13,14)9(17)16-5-3-15(4-6-16)7-1-2-7/h7-8H,1-6H2 |
| InChIKey | LRVMENSMSUXKAK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|