C8H9F4NO3 — CID 103803979
1-(2,2,3,3-tetrafluoropropanoyl)pyrrolidine-3-carboxylic acid (PubChem CID 103803979) has the molecular formula C8H9F4NO3 and a molecular weight of 243.16 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropanoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2,2,3,3-tetrafluoropropanoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 103803979 |
| Molecular Formula | C8H9F4NO3 |
| Molecular Weight | 243.16 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropanoyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C8H9F4NO3/c9-6(10)8(11,12)7(16)13-2-1-4(3-13)5(14)15/h4,6H,1-3H2,(H,14,15) |
| InChIKey | VOTYQLDPIJZLOJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.16 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|