C10H13F4NO3 — CID 122118908
5-methyl-1-(2,2,3,3-tetrafluoropropanoyl)piperidine-3-carboxylic acid (PubChem CID 122118908) has the molecular formula C10H13F4NO3 and a molecular weight of 271.21 g/mol. Its IUPAC name is 5-methyl-1-(2,2,3,3-tetrafluoropropanoyl)piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-(2,2,3,3-tetrafluoropropanoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122118908 |
| Molecular Formula | C10H13F4NO3 |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 5-methyl-1-(2,2,3,3-tetrafluoropropanoyl)piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C10H13F4NO3/c1-5-2-6(7(16)17)4-15(3-5)9(18)10(13,14)8(11)12/h5-6,8H,2-4H2,1H3,(H,16,17) |
| InChIKey | UALFRPSMCTWANA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|