C13H20F4N2O4 — CID 122123623
5-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 122123623) has the molecular formula C13H20F4N2O4 and a molecular weight of 344.31 g/mol. Its IUPAC name is 5-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122123623 |
| Molecular Formula | C13H20F4N2O4 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 5-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)ethylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)NCCOCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C13H20F4N2O4/c1-8-4-9(10(20)21)6-19(5-8)12(22)18-2-3-23-7-13(16,17)11(14)15/h8-9,11H,2-7H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | KIDYVJLXWVRHNU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|