C11H18F2N2O4 — CID 114128611
(3S,4S)-1-[2-(2,2-difluoroethoxy)ethylcarbamoyl]-4-methylpyrrolidine-3-carboxylic acid (PubChem CID 114128611) has the molecular formula C11H18F2N2O4 and a molecular weight of 280.27 g/mol. Its IUPAC name is (3S,4S)-1-[2-(2,2-difluoroethoxy)ethylcarbamoyl]-4-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-[2-(2,2-difluoroethoxy)ethylcarbamoyl]-4-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114128611 |
| Molecular Formula | C11H18F2N2O4 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (3S,4S)-1-[2-(2,2-difluoroethoxy)ethylcarbamoyl]-4-methylpyrrolidine-3-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)NCCOCC(F)F)C[C@H]1C(=O)O |
| InChI | InChI=1S/C11H18F2N2O4/c1-7-4-15(5-8(7)10(16)17)11(18)14-2-3-19-6-9(12)13/h7-9H,2-6H2,1H3,(H,14,18)(H,16,17)/t7-,8-/m1/s1 |
| InChIKey | QHAZZWNKKIESBZ-HTQZYQBOSA-N |
| XLogP | 0.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|