C9H13F4NO — CID 103733960
1-(2,4-dimethylpyrrolidin-1-yl)-2,2,3,3-tetrafluoropropan-1-one (PubChem CID 103733960) has the molecular formula C9H13F4NO and a molecular weight of 227.20 g/mol. Its IUPAC name is 1-(2,4-dimethylpyrrolidin-1-yl)-2,2,3,3-tetrafluoropropan-1-one.
| Compound Name | 1-(2,4-dimethylpyrrolidin-1-yl)-2,2,3,3-tetrafluoropropan-1-one |
|---|---|
| PubChem CID | 103733960 |
| Molecular Formula | C9H13F4NO |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 1-(2,4-dimethylpyrrolidin-1-yl)-2,2,3,3-tetrafluoropropan-1-one |
| SMILES | CC1CC(C)N(C(=O)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C9H13F4NO/c1-5-3-6(2)14(4-5)8(15)9(12,13)7(10)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | XRFVCUFRIRNTQH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|