C10H19NO2 — CID 130711049
1-(2,4-dimethylpyrrolidin-1-yl)-2-hydroxybutan-1-one (PubChem CID 130711049) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(2,4-dimethylpyrrolidin-1-yl)-2-hydroxybutan-1-one.
| Compound Name | 1-(2,4-dimethylpyrrolidin-1-yl)-2-hydroxybutan-1-one |
|---|---|
| PubChem CID | 130711049 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-(2,4-dimethylpyrrolidin-1-yl)-2-hydroxybutan-1-one |
| SMILES | CCC(O)C(=O)N1CC(C)CC1C |
| InChI | InChI=1S/C10H19NO2/c1-4-9(12)10(13)11-6-7(2)5-8(11)3/h7-9,12H,4-6H2,1-3H3 |
| InChIKey | WVCVIEMEPKUNDC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |