C11H16F4N2O2 — CID 103732065
2-methyl-1-[4-(2,2,3,3-tetrafluoropropanoyl)piperazin-1-yl]propan-1-one (PubChem CID 103732065) has the molecular formula C11H16F4N2O2 and a molecular weight of 284.25 g/mol. Its IUPAC name is 2-methyl-1-[4-(2,2,3,3-tetrafluoropropanoyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[4-(2,2,3,3-tetrafluoropropanoyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 103732065 |
| Molecular Formula | C11H16F4N2O2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-methyl-1-[4-(2,2,3,3-tetrafluoropropanoyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1CCN(C(=O)C(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C11H16F4N2O2/c1-7(2)8(18)16-3-5-17(6-4-16)10(19)11(14,15)9(12)13/h7,9H,3-6H2,1-2H3 |
| InChIKey | XQNCAJUWJLHUIR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|