C17H38N4O — CID 142367954
ethane;N-methyl-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]acetamide (PubChem CID 142367954) has the molecular formula C17H38N4O and a molecular weight of 314.52 g/mol. Its IUPAC name is ethane;N-methyl-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]acetamide.
| Compound Name | ethane;N-methyl-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 142367954 |
| Molecular Formula | C17H38N4O |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | ethane;N-methyl-2-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]acetamide |
| SMILES | CC.CC.CNC(=O)CN1CCC(N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C13H26N4O.2C2H6/c1-14-13(18)11-16-5-3-12(4-6-16)17-9-7-15(2)8-10-17;2*1-2/h12H,3-11H2,1-2H3,(H,14,18);2*1-2H3 |
| InChIKey | NTFVGCYBWMNDDI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |