C16H33N3O — CID 142390398
ethane;N-methyl-2-[4-(piperidin-1-ylmethyl)piperidin-1-yl]acetamide (PubChem CID 142390398) has the molecular formula C16H33N3O and a molecular weight of 283.46 g/mol. Its IUPAC name is ethane;N-methyl-2-[4-(piperidin-1-ylmethyl)piperidin-1-yl]acetamide.
| Compound Name | ethane;N-methyl-2-[4-(piperidin-1-ylmethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 142390398 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | ethane;N-methyl-2-[4-(piperidin-1-ylmethyl)piperidin-1-yl]acetamide |
| SMILES | CC.CNC(=O)CN1CCC(CN2CCCCC2)CC1 |
| InChI | InChI=1S/C14H27N3O.C2H6/c1-15-14(18)12-17-9-5-13(6-10-17)11-16-7-3-2-4-8-16;1-2/h13H,2-12H2,1H3,(H,15,18);1-2H3 |
| InChIKey | JNZMRDDGTQSOPS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |