C12H21N3O — CID 121185551
2-(5-cyclopropyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-N-methylacetamide (PubChem CID 121185551) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(5-cyclopropyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-N-methylacetamide.
| Compound Name | 2-(5-cyclopropyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 121185551 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-(5-cyclopropyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)-N-methylacetamide |
| SMILES | CNC(=O)CN1CC2CN(C3CC3)CC2C1 |
| InChI | InChI=1S/C12H21N3O/c1-13-12(16)8-14-4-9-6-15(11-2-3-11)7-10(9)5-14/h9-11H,2-8H2,1H3,(H,13,16) |
| InChIKey | ZWFYEBCMYVWCLT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |