C9H18N2OS — CID 122236789
(3R,4R)-4-(1,4-thiazepan-4-yl)pyrrolidin-3-ol (PubChem CID 122236789) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is (3R,4R)-4-(1,4-thiazepan-4-yl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(1,4-thiazepan-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 122236789 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (3R,4R)-4-(1,4-thiazepan-4-yl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CNC[C@H]1N1CCCSCC1 |
| InChI | InChI=1S/C9H18N2OS/c12-9-7-10-6-8(9)11-2-1-4-13-5-3-11/h8-10,12H,1-7H2/t8-,9-/m1/s1 |
| InChIKey | KEBYHHCYXADYJS-RKDXNWHRSA-N |
| XLogP | -0.24 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |