C28H30FN3O2 — CID 45137552
[(4R)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-4-yl] 3-phenylbenzoate (PubChem CID 45137552) has the molecular formula C28H30FN3O2 and a molecular weight of 459.57 g/mol. Its IUPAC name is [(4R)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-4-yl] 3-phenylbenzoate.
| Compound Name | [(4R)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-4-yl] 3-phenylbenzoate |
|---|---|
| PubChem CID | 45137552 |
| Molecular Formula | C28H30FN3O2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | [(4R)-3-[4-(4-fluorophenyl)piperazin-1-yl]piperidin-4-yl] 3-phenylbenzoate |
| SMILES | O=C(O[C@@H]1CCNCC1N1CCN(c2ccc(F)cc2)CC1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H30FN3O2/c29-24-9-11-25(12-10-24)31-15-17-32(18-16-31)26-20-30-14-13-27(26)34-28(33)23-8-4-7-22(19-23)21-5-2-1-3-6-21/h1-12,19,26-27,30H,13-18,20H2/t26?,27-/m1/s1 |
| InChIKey | DEEDSCIAIDQUCY-SSYAZFEXSA-N |
| XLogP | 4.20 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |