C35H38N4O5 — CID 45136976
[(3R,4R)-1-[(3-methoxyphenyl)carbamoyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-3-yl] naphthalene-2-carboxylate (PubChem CID 45136976) has the molecular formula C35H38N4O5 and a molecular weight of 594.71 g/mol. Its IUPAC name is [(3R,4R)-1-[(3-methoxyphenyl)carbamoyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-3-yl] naphthalene-2-carboxylate.
| Compound Name | [(3R,4R)-1-[(3-methoxyphenyl)carbamoyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-3-yl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 45136976 |
| Molecular Formula | C35H38N4O5 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | [(3R,4R)-1-[(3-methoxyphenyl)carbamoyl]-4-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-3-yl] naphthalene-2-carboxylate |
| SMILES | COc1ccc(N2CCN([C@@H]3CCN(C(=O)Nc4cccc(OC)c4)C[C@H]3OC(=O)c3ccc4ccccc4c3)CC2)cc1 |
| InChI | InChI=1S/C35H38N4O5/c1-42-30-14-12-29(13-15-30)37-18-20-38(21-19-37)32-16-17-39(35(41)36-28-8-5-9-31(23-28)43-2)24-33(32)44-34(40)27-11-10-25-6-3-4-7-26(25)22-27/h3-15,22-23,32-33H,16-21,24H2,1-2H3,(H,36,41)/t32-,33-/m1/s1 |
| InChIKey | JXNVDRSYKRYEHE-CZNDPXEESA-N |
| XLogP | 5.51 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|