About [(3R,4R)-4-phenylpiperidin-3-yl] acetate
[(3R,4R)-4-phenylpiperidin-3-yl] acetate (PubChem CID 59674879) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is [(3R,4R)-4-phenylpiperidin-3-yl] acetate.
Molecular Properties
| Compound Name | [(3R,4R)-4-phenylpiperidin-3-yl] acetate |
| PubChem CID | 59674879 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | [(3R,4R)-4-phenylpiperidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CNCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H17NO2/c1-10(15)16-13-9-14-8-7-12(13)11-5-3-2-4-6-11/h2-6,12-14H,7-9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | XKRGIUMPXSHTBT-OLZOCXBDSA-N |
| XLogP | 1.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4R)-4-phenylpiperidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-phenylpiperidin-3-yl] acetate?
The IUPAC name of [(3R,4R)-4-phenylpiperidin-3-yl] acetate (CID 59674879) is [(3R,4R)-4-phenylpiperidin-3-yl] acetate.
What is the SMILES notation for [(3R,4R)-4-phenylpiperidin-3-yl] acetate?
The canonical SMILES for [(3R,4R)-4-phenylpiperidin-3-yl] acetate is CC(=O)O[C@H]1CNCC[C@@H]1c1ccccc1.
What is the InChIKey of [(3R,4R)-4-phenylpiperidin-3-yl] acetate?
The InChIKey is XKRGIUMPXSHTBT-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H17NO2/c1-10(15)16-13-9-14-8-7-12(13)11-5-3-2-4-6-11/h2-6,12-14H,7-9H2,1H3/t12-,13+/m1/s1.
What are the key properties of [(3R,4R)-4-phenylpiperidin-3-yl] acetate?
[(3R,4R)-4-phenylpiperidin-3-yl] acetate has a molecular weight of 219.28 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-phenylpiperidin-3-yl] acetate is sourced from PubChem (CID 59674879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).