About [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate
[(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate (PubChem CID 688564) has the molecular formula C21H25NO2
and a molecular weight of 323.44 g/mol. Its IUPAC name is [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate.
Molecular Properties
| Compound Name | [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate |
| PubChem CID | 688564 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate |
| SMILES | CCN1CCC[C@@H](OC(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H25NO2/c1-2-22-15-9-14-19(16-22)24-21(23)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,19-20H,2,9,14-16H2,1H3/t19-/m1/s1 |
| InChIKey | KTHVBAZBLKXIHZ-LJQANCHMSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate?
The IUPAC name of [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate (CID 688564) is [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate.
What is the SMILES notation for [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate?
The canonical SMILES for [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate is CCN1CCC[C@@H](OC(=O)C(c2ccccc2)c2ccccc2)C1.
What is the InChIKey of [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate?
The InChIKey is KTHVBAZBLKXIHZ-LJQANCHMSA-N. The full InChI is InChI=1S/C21H25NO2/c1-2-22-15-9-14-19(16-22)24-21(23)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,19-20H,2,9,14-16H2,1H3/t19-/m1/s1.
What are the key properties of [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate?
[(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate has a molecular weight of 323.44 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-ethylpiperidin-3-yl] 2,2-diphenylacetate is sourced from PubChem (CID 688564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).