C30H28N2O2 — CID 25115052
4-phenoxy-N-[(3R,4R)-4-(4-phenylphenyl)piperidin-3-yl]benzamide (PubChem CID 25115052) has the molecular formula C30H28N2O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-phenoxy-N-[(3R,4R)-4-(4-phenylphenyl)piperidin-3-yl]benzamide.
| Compound Name | 4-phenoxy-N-[(3R,4R)-4-(4-phenylphenyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 25115052 |
| Molecular Formula | C30H28N2O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-phenoxy-N-[(3R,4R)-4-(4-phenylphenyl)piperidin-3-yl]benzamide |
| SMILES | O=C(N[C@H]1CNCC[C@@H]1c1ccc(-c2ccccc2)cc1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O2/c33-30(25-15-17-27(18-16-25)34-26-9-5-2-6-10-26)32-29-21-31-20-19-28(29)24-13-11-23(12-14-24)22-7-3-1-4-8-22/h1-18,28-29,31H,19-21H2,(H,32,33)/t28-,29+/m1/s1 |
| InChIKey | WZAGNCUHKGMXBP-WDYNHAJCSA-N |
| XLogP | 6.02 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |