C20H23N2O2+ — CID 7831592
N-[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl]-4-phenoxybenzamide (PubChem CID 7831592) has the molecular formula C20H23N2O2+ and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl]-4-phenoxybenzamide.
| Compound Name | N-[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 7831592 |
| Molecular Formula | C20H23N2O2+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-[(3S)-1-azoniabicyclo[2.2.2]octan-3-yl]-4-phenoxybenzamide |
| SMILES | O=C(N[C@@H]1C[NH+]2CCC1CC2)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O2/c23-20(21-19-14-22-12-10-15(19)11-13-22)16-6-8-18(9-7-16)24-17-4-2-1-3-5-17/h1-9,15,19H,10-14H2,(H,21,23)/p+1/t19-/m1/s1 |
| InChIKey | INQFYMZPQQUPIU-LJQANCHMSA-O |
| XLogP | 1.89 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |