C28H22N4O5 — CID 21231530
4-[4-(benzamidocarbamoyl)phenoxy]-N'-benzoylbenzohydrazide (PubChem CID 21231530) has the molecular formula C28H22N4O5 and a molecular weight of 494.51 g/mol. Its IUPAC name is 4-[4-(benzamidocarbamoyl)phenoxy]-N'-benzoylbenzohydrazide.
| Compound Name | 4-[4-(benzamidocarbamoyl)phenoxy]-N'-benzoylbenzohydrazide |
|---|---|
| PubChem CID | 21231530 |
| Molecular Formula | C28H22N4O5 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 4-[4-(benzamidocarbamoyl)phenoxy]-N'-benzoylbenzohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(Oc2ccc(C(=O)NNC(=O)c3ccccc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N4O5/c33-25(19-7-3-1-4-8-19)29-31-27(35)21-11-15-23(16-12-21)37-24-17-13-22(14-18-24)28(36)32-30-26(34)20-9-5-2-6-10-20/h1-18H,(H,29,33)(H,30,34)(H,31,35)(H,32,36) |
| InChIKey | XBYNBOJAMOQNMN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|