C21H23N3O3 — CID 18337457
3-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]phenoxy]benzamide (PubChem CID 18337457) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]phenoxy]benzamide.
| Compound Name | 3-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 18337457 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 3-[4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1cccc(Oc2ccc(C(=O)N[C@H]3CN4CCC3CC4)cc2)c1 |
| InChI | InChI=1S/C21H23N3O3/c22-20(25)16-2-1-3-18(12-16)27-17-6-4-15(5-7-17)21(26)23-19-13-24-10-8-14(19)9-11-24/h1-7,12,14,19H,8-11,13H2,(H2,22,25)(H,23,26)/t19-/m0/s1 |
| InChIKey | GMFPEVSTBOCCEY-IBGZPJMESA-N |
| XLogP | 2.40 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |