C20H23N3O4S — CID 18383961
N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(2-sulfamoylphenoxy)benzamide (PubChem CID 18383961) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(2-sulfamoylphenoxy)benzamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(2-sulfamoylphenoxy)benzamide |
|---|---|
| PubChem CID | 18383961 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(2-sulfamoylphenoxy)benzamide |
| SMILES | NS(=O)(=O)c1ccccc1Oc1ccc(C(=O)NC2CN3CCC2CC3)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c21-28(25,26)19-4-2-1-3-18(19)27-16-7-5-15(6-8-16)20(24)22-17-13-23-11-9-14(17)10-12-23/h1-8,14,17H,9-13H2,(H,22,24)(H2,21,25,26) |
| InChIKey | ITTDTTWGRWARQI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |