C14H17IN2O — CID 11325679
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-(125I)iodo(125I)benzamide (PubChem CID 11325679) has the molecular formula C14H17IN2O and a molecular weight of 354.21 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-(125I)iodo(125I)benzamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-(125I)iodo(125I)benzamide |
|---|---|
| PubChem CID | 11325679 |
| Molecular Formula | C14H17IN2O |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-(125I)iodo(125I)benzamide |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1ccc([125I])cc1 |
| InChI | InChI=1S/C14H17IN2O/c15-12-3-1-11(2-4-12)14(18)16-13-9-17-7-5-10(13)6-8-17/h1-4,10,13H,5-9H2,(H,16,18)/t13-/m0/s1/i15-2 |
| InChIKey | OOGWQHRFIFVTEZ-SRYZFZKRSA-N |
| XLogP | 2.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|