C15H19IN2OS — CID 89102396
N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(iodomethylsulfanyl)benzamide (PubChem CID 89102396) has the molecular formula C15H19IN2OS and a molecular weight of 402.30 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(iodomethylsulfanyl)benzamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(iodomethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 89102396 |
| Molecular Formula | C15H19IN2OS |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(iodomethylsulfanyl)benzamide |
| SMILES | O=C(NC1CN2CCC1CC2)c1ccc(SCI)cc1 |
| InChI | InChI=1S/C15H19IN2OS/c16-10-20-13-3-1-12(2-4-13)15(19)17-14-9-18-7-5-11(14)6-8-18/h1-4,11,14H,5-10H2,(H,17,19) |
| InChIKey | IWOOYEQXNVFARA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|