C18H19ClN2OS2 — CID 18383467
N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(4-chlorothiophen-2-yl)sulfanylbenzamide (PubChem CID 18383467) has the molecular formula C18H19ClN2OS2 and a molecular weight of 378.95 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(4-chlorothiophen-2-yl)sulfanylbenzamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(4-chlorothiophen-2-yl)sulfanylbenzamide |
|---|---|
| PubChem CID | 18383467 |
| Molecular Formula | C18H19ClN2OS2 |
| Molecular Weight | 378.95 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-(4-chlorothiophen-2-yl)sulfanylbenzamide |
| SMILES | O=C(NC1CN2CCC1CC2)c1ccc(Sc2cc(Cl)cs2)cc1 |
| InChI | InChI=1S/C18H19ClN2OS2/c19-14-9-17(23-11-14)24-15-3-1-13(2-4-15)18(22)20-16-10-21-7-5-12(16)6-8-21/h1-4,9,11-12,16H,5-8,10H2,(H,20,22) |
| InChIKey | LIPTUAJNRNMKKT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.95 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |