C19H19F3N2OS2 — CID 18399885
N-(1-azabicyclo[2.2.2]octan-3-yl)-4-[5-(trifluoromethyl)thiophen-2-yl]sulfanylbenzamide (PubChem CID 18399885) has the molecular formula C19H19F3N2OS2 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-4-[5-(trifluoromethyl)thiophen-2-yl]sulfanylbenzamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-[5-(trifluoromethyl)thiophen-2-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 18399885 |
| Molecular Formula | C19H19F3N2OS2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-4-[5-(trifluoromethyl)thiophen-2-yl]sulfanylbenzamide |
| SMILES | O=C(NC1CN2CCC1CC2)c1ccc(Sc2ccc(C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C19H19F3N2OS2/c20-19(21,22)16-5-6-17(27-16)26-14-3-1-13(2-4-14)18(25)23-15-11-24-9-7-12(15)8-10-24/h1-6,12,15H,7-11H2,(H,23,25) |
| InChIKey | UMWSAHAIFZJQMP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |