C17H20N4OS2 — CID 18181835
5-(4-aminophenyl)sulfanyl-N-(1-azabicyclo[2.2.2]octan-3-yl)-1,3-thiazole-2-carboxamide (PubChem CID 18181835) has the molecular formula C17H20N4OS2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 5-(4-aminophenyl)sulfanyl-N-(1-azabicyclo[2.2.2]octan-3-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | 5-(4-aminophenyl)sulfanyl-N-(1-azabicyclo[2.2.2]octan-3-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 18181835 |
| Molecular Formula | C17H20N4OS2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 5-(4-aminophenyl)sulfanyl-N-(1-azabicyclo[2.2.2]octan-3-yl)-1,3-thiazole-2-carboxamide |
| SMILES | Nc1ccc(Sc2cnc(C(=O)NC3CN4CCC3CC4)s2)cc1 |
| InChI | InChI=1S/C17H20N4OS2/c18-12-1-3-13(4-2-12)23-15-9-19-17(24-15)16(22)20-14-10-21-7-5-11(14)6-8-21/h1-4,9,11,14H,5-8,10,18H2,(H,20,22) |
| InChIKey | UTUDETIQYCBZNR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|