C20H22N2O4 — CID 119070407
methyl 3-[4-[[(3R,4R)-3-hydroxypiperidin-4-yl]carbamoyl]phenyl]benzoate (PubChem CID 119070407) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl 3-[4-[[(3R,4R)-3-hydroxypiperidin-4-yl]carbamoyl]phenyl]benzoate.
| Compound Name | methyl 3-[4-[[(3R,4R)-3-hydroxypiperidin-4-yl]carbamoyl]phenyl]benzoate |
|---|---|
| PubChem CID | 119070407 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl 3-[4-[[(3R,4R)-3-hydroxypiperidin-4-yl]carbamoyl]phenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(C(=O)N[C@@H]3CCNC[C@H]3O)cc2)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-26-20(25)16-4-2-3-15(11-16)13-5-7-14(8-6-13)19(24)22-17-9-10-21-12-18(17)23/h2-8,11,17-18,21,23H,9-10,12H2,1H3,(H,22,24)/t17-,18-/m1/s1 |
| InChIKey | VVSWFWCSTOCBCM-QZTJIDSGSA-N |
| XLogP | 1.59 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |