C20H24N2O4 — CID 121498106
4-(3,5-dimethoxyphenyl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzamide (PubChem CID 121498106) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzamide.
| Compound Name | 4-(3,5-dimethoxyphenyl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 121498106 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]benzamide |
| SMILES | COc1cc(OC)cc(-c2ccc(C(=O)N[C@@H]3CCNC[C@H]3O)cc2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-25-16-9-15(10-17(11-16)26-2)13-3-5-14(6-4-13)20(24)22-18-7-8-21-12-19(18)23/h3-6,9-11,18-19,21,23H,7-8,12H2,1-2H3,(H,22,24)/t18-,19-/m1/s1 |
| InChIKey | FEXAEABFMOAREV-RTBURBONSA-N |
| XLogP | 1.82 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |