C13H18ClNO2 — CID 45074282
methyl 3-[(3R)-piperidin-3-yl]benzoate;hydrochloride (PubChem CID 45074282) has the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. Its IUPAC name is methyl 3-[(3R)-piperidin-3-yl]benzoate;hydrochloride.
| Compound Name | methyl 3-[(3R)-piperidin-3-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 45074282 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | methyl 3-[(3R)-piperidin-3-yl]benzoate;hydrochloride |
| SMILES | COC(=O)c1cccc([C@H]2CCCNC2)c1.Cl |
| InChI | InChI=1S/C13H17NO2.ClH/c1-16-13(15)11-5-2-4-10(8-11)12-6-3-7-14-9-12;/h2,4-5,8,12,14H,3,6-7,9H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | UQOYCWKTROFSHT-YDALLXLXSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |