C15H21NO2 — CID 22856993
methyl 3-[(3S)-1-ethylpiperidin-3-yl]benzoate (PubChem CID 22856993) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is methyl 3-[(3S)-1-ethylpiperidin-3-yl]benzoate.
| Compound Name | methyl 3-[(3S)-1-ethylpiperidin-3-yl]benzoate |
|---|---|
| PubChem CID | 22856993 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | methyl 3-[(3S)-1-ethylpiperidin-3-yl]benzoate |
| SMILES | CCN1CCC[C@@H](c2cccc(C(=O)OC)c2)C1 |
| InChI | InChI=1S/C15H21NO2/c1-3-16-9-5-8-14(11-16)12-6-4-7-13(10-12)15(17)18-2/h4,6-7,10,14H,3,5,8-9,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | SNKPKJWGOLSNBT-CQSZACIVSA-N |
| XLogP | 2.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |