C18H24N4O — CID 99939569
N-[(2,5-dimethylpyrazol-3-yl)methyl]-3-[(3S)-piperidin-3-yl]benzamide (PubChem CID 99939569) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[(2,5-dimethylpyrazol-3-yl)methyl]-3-[(3S)-piperidin-3-yl]benzamide.
| Compound Name | N-[(2,5-dimethylpyrazol-3-yl)methyl]-3-[(3S)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 99939569 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-[(2,5-dimethylpyrazol-3-yl)methyl]-3-[(3S)-piperidin-3-yl]benzamide |
| SMILES | Cc1cc(CNC(=O)c2cccc([C@@H]3CCCNC3)c2)n(C)n1 |
| InChI | InChI=1S/C18H24N4O/c1-13-9-17(22(2)21-13)12-20-18(23)15-6-3-5-14(10-15)16-7-4-8-19-11-16/h3,5-6,9-10,16,19H,4,7-8,11-12H2,1-2H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | IPHHVCIQUUJERQ-MRXNPFEDSA-N |
| XLogP | 2.13 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |